C36H68O6Si3 — CID 18598743
2-[4-[(4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]but-2-ynoxy]propanoic acid (PubChem CID 18598743) has the molecular formula C36H68O6Si3 and a molecular weight of 681.19 g/mol. Its IUPAC name is 2-[4-[(4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]but-2-ynoxy]propanoic acid.
| Compound Name | 2-[4-[(4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]but-2-ynoxy]propanoic acid |
|---|---|
| PubChem CID | 18598743 |
| Molecular Formula | C36H68O6Si3 |
| Molecular Weight | 681.19 g/mol |
| Exact Mass | 680.43 |
| IUPAC Name | 2-[4-[(4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]but-2-ynoxy]propanoic acid |
| SMILES | CCCCC(C)(C/C=C/[C@H]1C(CC#CCOC(C)C(=O)O)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](CC)(CC)CC)O[Si](C)(C)C |
| InChI | InChI=1S/C36H68O6Si3/c1-15-19-25-36(9,42-43(10,11)12)26-22-24-31-30(23-20-21-27-39-29(5)34(37)38)32(40-44(13,14)35(6,7)8)28-33(31)41-45(16-2,17-3)18-4/h22,24,29,31,33H,15-19,23,25-28H2,1-14H3,(H,37,38)/b24-22+/t29?,31-,33-,36?/m0/s1 |
| InChIKey | UXFDNJCKHHGHQT-GSVUXYFPSA-N |
| XLogP | 10.30 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.19 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|