C18H15F6NO3 — CID 18598750
(E)-N-(1,3-dioxan-2-ylmethoxy)-2,2,2-trifluoro-1-[3-(trifluoromethyl)naphthalen-1-yl]ethanimine (PubChem CID 18598750) has the molecular formula C18H15F6NO3 and a molecular weight of 407.31 g/mol. Its IUPAC name is (E)-N-(1,3-dioxan-2-ylmethoxy)-2,2,2-trifluoro-1-[3-(trifluoromethyl)naphthalen-1-yl]ethanimine.
| Compound Name | (E)-N-(1,3-dioxan-2-ylmethoxy)-2,2,2-trifluoro-1-[3-(trifluoromethyl)naphthalen-1-yl]ethanimine |
|---|---|
| PubChem CID | 18598750 |
| Molecular Formula | C18H15F6NO3 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | (E)-N-(1,3-dioxan-2-ylmethoxy)-2,2,2-trifluoro-1-[3-(trifluoromethyl)naphthalen-1-yl]ethanimine |
| SMILES | FC(F)(F)/C(=N/OCC1OCCCO1)c1cc(C(F)(F)F)cc2ccccc12 |
| InChI | InChI=1S/C18H15F6NO3/c19-17(20,21)12-8-11-4-1-2-5-13(11)14(9-12)16(18(22,23)24)25-28-10-15-26-6-3-7-27-15/h1-2,4-5,8-9,15H,3,6-7,10H2/b25-16+ |
| InChIKey | WDFXFXWQUNOXGS-PCLIKHOPSA-N |
| XLogP | 4.90 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|