C9H13NO — CID 18599125
N-[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroinden-2-ylidene]hydroxylamine (PubChem CID 18599125) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is N-[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroinden-2-ylidene]hydroxylamine.
| Compound Name | N-[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroinden-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 18599125 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | N-[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroinden-2-ylidene]hydroxylamine |
| SMILES | O/N=C1\C[C@H]2CC=CC[C@H]2C1 |
| InChI | InChI=1S/C9H13NO/c11-10-9-5-7-3-1-2-4-8(7)6-9/h1-2,7-8,11H,3-6H2/b10-9-/t7-,8+/m0/s1 |
| InChIKey | MELGDDNFBQIRSF-UFPBWDQISA-N |
| XLogP | 2.19 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|