C10H16O3 — CID 18599404
(1R,4S)-1,4,5,6-tetramethyl-7-oxabicyclo[2.2.1]hept-5-ene-2,3-diol (PubChem CID 18599404) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (1R,4S)-1,4,5,6-tetramethyl-7-oxabicyclo[2.2.1]hept-5-ene-2,3-diol.
| Compound Name | (1R,4S)-1,4,5,6-tetramethyl-7-oxabicyclo[2.2.1]hept-5-ene-2,3-diol |
|---|---|
| PubChem CID | 18599404 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (1R,4S)-1,4,5,6-tetramethyl-7-oxabicyclo[2.2.1]hept-5-ene-2,3-diol |
| SMILES | CC1=C(C)[C@@]2(C)O[C@]1(C)C(O)C2O |
| InChI | InChI=1S/C10H16O3/c1-5-6(2)10(4)8(12)7(11)9(5,3)13-10/h7-8,11-12H,1-4H3/t7?,8?,9-,10+ |
| InChIKey | JRWHSZUJWGAXFF-OXYCZDQYSA-N |
| XLogP | 0.61 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|