About N-[2-[(2R,3R)-3-amino-4-oxoazetidin-2-yl]sulfanylethyl]acetamide
N-[2-[(2R,3R)-3-amino-4-oxoazetidin-2-yl]sulfanylethyl]acetamide (PubChem CID 18599828) has the molecular formula C7H13N3O2S
and a molecular weight of 203.27 g/mol. Its IUPAC name is N-[2-[(2R,3R)-3-amino-4-oxoazetidin-2-yl]sulfanylethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-[(2R,3R)-3-amino-4-oxoazetidin-2-yl]sulfanylethyl]acetamide |
| PubChem CID | 18599828 |
| Molecular Formula | C7H13N3O2S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | N-[2-[(2R,3R)-3-amino-4-oxoazetidin-2-yl]sulfanylethyl]acetamide |
| SMILES | CC(=O)NCCS[C@H]1NC(=O)[C@H]1N |
| InChI | InChI=1S/C7H13N3O2S/c1-4(11)9-2-3-13-7-5(8)6(12)10-7/h5,7H,2-3,8H2,1H3,(H,9,11)(H,10,12)/t5-,7-/m1/s1 |
| InChIKey | PMAWTMUBGVZZQS-IYSWYEEDSA-N |
| XLogP | -1.36 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(2R,3R)-3-amino-4-oxoazetidin-2-yl]sulfanylethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2R,3R)-3-amino-4-oxoazetidin-2-yl]sulfanylethyl]acetamide?
The IUPAC name of N-[2-[(2R,3R)-3-amino-4-oxoazetidin-2-yl]sulfanylethyl]acetamide (CID 18599828) is N-[2-[(2R,3R)-3-amino-4-oxoazetidin-2-yl]sulfanylethyl]acetamide.
What is the SMILES notation for N-[2-[(2R,3R)-3-amino-4-oxoazetidin-2-yl]sulfanylethyl]acetamide?
The canonical SMILES for N-[2-[(2R,3R)-3-amino-4-oxoazetidin-2-yl]sulfanylethyl]acetamide is CC(=O)NCCS[C@H]1NC(=O)[C@H]1N.
What is the InChIKey of N-[2-[(2R,3R)-3-amino-4-oxoazetidin-2-yl]sulfanylethyl]acetamide?
The InChIKey is PMAWTMUBGVZZQS-IYSWYEEDSA-N. The full InChI is InChI=1S/C7H13N3O2S/c1-4(11)9-2-3-13-7-5(8)6(12)10-7/h5,7H,2-3,8H2,1H3,(H,9,11)(H,10,12)/t5-,7-/m1/s1.
What are the key properties of N-[2-[(2R,3R)-3-amino-4-oxoazetidin-2-yl]sulfanylethyl]acetamide?
N-[2-[(2R,3R)-3-amino-4-oxoazetidin-2-yl]sulfanylethyl]acetamide has a molecular weight of 203.27 g/mol, XLogP of -1.36, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2R,3R)-3-amino-4-oxoazetidin-2-yl]sulfanylethyl]acetamide is sourced from PubChem (CID 18599828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).