C10H17NO2 — CID 18600295
(4aR,8aR)-7-methoxy-4-methyl-2,3,4a,5,8,8a-hexahydro-1,4-benzoxazine (PubChem CID 18600295) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (4aR,8aR)-7-methoxy-4-methyl-2,3,4a,5,8,8a-hexahydro-1,4-benzoxazine.
| Compound Name | (4aR,8aR)-7-methoxy-4-methyl-2,3,4a,5,8,8a-hexahydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 18600295 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (4aR,8aR)-7-methoxy-4-methyl-2,3,4a,5,8,8a-hexahydro-1,4-benzoxazine |
| SMILES | COC1=CC[C@@H]2[C@@H](C1)OCCN2C |
| InChI | InChI=1S/C10H17NO2/c1-11-5-6-13-10-7-8(12-2)3-4-9(10)11/h3,9-10H,4-7H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | RHAPKANSNIKOGO-NXEZZACHSA-N |
| XLogP | 1.01 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |