C25H40F2O6 — CID 18600690
(3R,3aS,4S,5S,6aR)-3-fluoro-4-[(E)-4-fluoro-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 18600690) has the molecular formula C25H40F2O6 and a molecular weight of 474.59 g/mol. Its IUPAC name is (3R,3aS,4S,5S,6aR)-3-fluoro-4-[(E)-4-fluoro-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (3R,3aS,4S,5S,6aR)-3-fluoro-4-[(E)-4-fluoro-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 18600690 |
| Molecular Formula | C25H40F2O6 |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | (3R,3aS,4S,5S,6aR)-3-fluoro-4-[(E)-4-fluoro-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CCCCC(F)C(/C=C/[C@H]1[C@H]2[C@@H](C[C@@H]1OC1CCCCO1)OC(O)[C@@H]2F)OC1CCCCO1 |
| InChI | InChI=1S/C25H40F2O6/c1-2-3-8-17(26)18(31-21-9-4-6-13-29-21)12-11-16-19(32-22-10-5-7-14-30-22)15-20-23(16)24(27)25(28)33-20/h11-12,16-25,28H,2-10,13-15H2,1H3/b12-11+/t16-,17?,18?,19+,20-,21?,22?,23+,24-,25?/m1/s1 |
| InChIKey | QRBPBHPZYFLGSC-BHWGVMFCSA-N |
| XLogP | 4.59 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|