C26H43FO6 — CID 18600691
(3R,3aS,4S,5S,6aR)-3-fluoro-4-[(E)-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 18600691) has the molecular formula C26H43FO6 and a molecular weight of 470.62 g/mol. Its IUPAC name is (3R,3aS,4S,5S,6aR)-3-fluoro-4-[(E)-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (3R,3aS,4S,5S,6aR)-3-fluoro-4-[(E)-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 18600691 |
| Molecular Formula | C26H43FO6 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | (3R,3aS,4S,5S,6aR)-3-fluoro-4-[(E)-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CCCCC(C)C(/C=C/[C@H]1[C@H]2[C@@H](C[C@@H]1OC1CCCCO1)OC(O)[C@@H]2F)OC1CCCCO1 |
| InChI | InChI=1S/C26H43FO6/c1-3-4-9-17(2)19(31-22-10-5-7-14-29-22)13-12-18-20(32-23-11-6-8-15-30-23)16-21-24(18)25(27)26(28)33-21/h12-13,17-26,28H,3-11,14-16H2,1-2H3/b13-12+/t17?,18-,19?,20+,21-,22?,23?,24+,25-,26?/m1/s1 |
| InChIKey | HVRQMUQEVMCLMY-PEZKXWIWSA-N |
| XLogP | 4.88 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|