C25H39F3O6 — CID 18600693
(3R,3aS,4S,5S,6aR)-4-[(E)-4,4-difluoro-3-(oxan-2-yloxy)oct-1-enyl]-3-fluoro-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 18600693) has the molecular formula C25H39F3O6 and a molecular weight of 492.58 g/mol. Its IUPAC name is (3R,3aS,4S,5S,6aR)-4-[(E)-4,4-difluoro-3-(oxan-2-yloxy)oct-1-enyl]-3-fluoro-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (3R,3aS,4S,5S,6aR)-4-[(E)-4,4-difluoro-3-(oxan-2-yloxy)oct-1-enyl]-3-fluoro-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 18600693 |
| Molecular Formula | C25H39F3O6 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | (3R,3aS,4S,5S,6aR)-4-[(E)-4,4-difluoro-3-(oxan-2-yloxy)oct-1-enyl]-3-fluoro-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CCCCC(F)(F)C(/C=C/[C@H]1[C@H]2[C@@H](C[C@@H]1OC1CCCCO1)OC(O)[C@@H]2F)OC1CCCCO1 |
| InChI | InChI=1S/C25H39F3O6/c1-2-3-12-25(27,28)19(34-21-9-5-7-14-31-21)11-10-16-17(32-20-8-4-6-13-30-20)15-18-22(16)23(26)24(29)33-18/h10-11,16-24,29H,2-9,12-15H2,1H3/b11-10+/t16-,17+,18-,19?,20?,21?,22+,23-,24?/m1/s1 |
| InChIKey | AOZRJTGOLXIWPI-RBOJNGHZSA-N |
| XLogP | 4.88 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|