C22H36F2O4 — CID 18600696
(3R,3aS,4S,5S,6aR)-3-fluoro-4-[(E)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 18600696) has the molecular formula C22H36F2O4 and a molecular weight of 402.52 g/mol. Its IUPAC name is (3R,3aS,4S,5S,6aR)-3-fluoro-4-[(E)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (3R,3aS,4S,5S,6aR)-3-fluoro-4-[(E)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 18600696 |
| Molecular Formula | C22H36F2O4 |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | (3R,3aS,4S,5S,6aR)-3-fluoro-4-[(E)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CCCCC(C)(F)C(/C=C/[C@H]1[C@H]2[C@@H](C[C@@H]1C)OC(O)[C@@H]2F)OC1CCCCO1 |
| InChI | InChI=1S/C22H36F2O4/c1-4-5-11-22(3,24)17(28-18-8-6-7-12-26-18)10-9-15-14(2)13-16-19(15)20(23)21(25)27-16/h9-10,14-21,25H,4-8,11-13H2,1-3H3/b10-9+/t14-,15+,16+,17?,18?,19-,20+,21?,22?/m0/s1 |
| InChIKey | ZEIRFPFIUURSHU-CPQKBKFGSA-N |
| XLogP | 4.70 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|