C26H40F2O6 — CID 18600698
(3R,3aS,4S,5S,6aR)-3-fluoro-4-[(E)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 18600698) has the molecular formula C26H40F2O6 and a molecular weight of 486.60 g/mol. Its IUPAC name is (3R,3aS,4S,5S,6aR)-3-fluoro-4-[(E)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3R,3aS,4S,5S,6aR)-3-fluoro-4-[(E)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 18600698 |
| Molecular Formula | C26H40F2O6 |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | (3R,3aS,4S,5S,6aR)-3-fluoro-4-[(E)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCC(C)(F)C(/C=C/[C@H]1[C@H]2[C@@H](C[C@@H]1OC1CCCCO1)OC(=O)[C@@H]2F)OC1CCCCO1 |
| InChI | InChI=1S/C26H40F2O6/c1-3-4-13-26(2,28)20(34-22-10-6-8-15-31-22)12-11-17-18(32-21-9-5-7-14-30-21)16-19-23(17)24(27)25(29)33-19/h11-12,17-24H,3-10,13-16H2,1-2H3/b12-11+/t17-,18+,19-,20?,21?,22?,23+,24-,26?/m1/s1 |
| InChIKey | XLXALYCMXYYNPM-BCVFFBPJSA-N |
| XLogP | 5.18 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|