C22H35FO4 — CID 18600707
(3aS,4S,5S,6aR)-4-[(E,3R)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 18600707) has the molecular formula C22H35FO4 and a molecular weight of 382.52 g/mol. Its IUPAC name is (3aS,4S,5S,6aR)-4-[(E,3R)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aS,4S,5S,6aR)-4-[(E,3R)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 18600707 |
| Molecular Formula | C22H35FO4 |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | (3aS,4S,5S,6aR)-4-[(E,3R)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCC(C)(F)[C@@H](/C=C/[C@H]1[C@@H]2CC(=O)O[C@@H]2C[C@@H]1C)OC1CCCCO1 |
| InChI | InChI=1S/C22H35FO4/c1-4-5-11-22(3,23)19(27-21-8-6-7-12-25-21)10-9-16-15(2)13-18-17(16)14-20(24)26-18/h9-10,15-19,21H,4-8,11-14H2,1-3H3/b10-9+/t15-,16+,17-,18+,19+,21?,22?/m0/s1 |
| InChIKey | HEKFLAKGOFQKGB-CQHPJNNOSA-N |
| XLogP | 4.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|