C26H41FO6 — CID 18600708
(3aS,4S,5S,6aR)-4-[(E,3R)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 18600708) has the molecular formula C26H41FO6 and a molecular weight of 468.61 g/mol. Its IUPAC name is (3aS,4S,5S,6aR)-4-[(E,3R)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aS,4S,5S,6aR)-4-[(E,3R)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 18600708 |
| Molecular Formula | C26H41FO6 |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | (3aS,4S,5S,6aR)-4-[(E,3R)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCC(C)(F)[C@@H](/C=C/[C@H]1[C@@H]2CC(=O)O[C@@H]2C[C@@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C26H41FO6/c1-3-4-13-26(2,27)22(33-25-10-6-8-15-30-25)12-11-18-19-16-23(28)31-21(19)17-20(18)32-24-9-5-7-14-29-24/h11-12,18-22,24-25H,3-10,13-17H2,1-2H3/b12-11+/t18-,19-,20-,21+,22+,24?,25?,26?/m0/s1 |
| InChIKey | NBNWOHJKQRYWSR-CJMDQNIYSA-N |
| XLogP | 5.24 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|