C21H32F2O4 — CID 18600714
(3R,3aS,4S,6aR)-3-fluoro-4-[(E)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 18600714) has the molecular formula C21H32F2O4 and a molecular weight of 386.48 g/mol. Its IUPAC name is (3R,3aS,4S,6aR)-3-fluoro-4-[(E)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3R,3aS,4S,6aR)-3-fluoro-4-[(E)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 18600714 |
| Molecular Formula | C21H32F2O4 |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | (3R,3aS,4S,6aR)-3-fluoro-4-[(E)-4-fluoro-4-methyl-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCC(C)(F)C(/C=C/[C@@H]1CC[C@H]2OC(=O)[C@H](F)[C@@H]12)OC1CCCCO1 |
| InChI | InChI=1S/C21H32F2O4/c1-3-4-12-21(2,23)16(27-17-7-5-6-13-25-17)11-9-14-8-10-15-18(14)19(22)20(24)26-15/h9,11,14-19H,3-8,10,12-13H2,1-2H3/b11-9+/t14-,15+,16?,17?,18-,19+,21?/m0/s1 |
| InChIKey | SPYKIHFNPKNBKW-TVWRVRQFSA-N |
| XLogP | 4.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|