C21H33FO4 — CID 18600721
(3S,3aS,4S,5S,6aR)-3-fluoro-5-methyl-4-[(E)-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 18600721) has the molecular formula C21H33FO4 and a molecular weight of 368.49 g/mol. Its IUPAC name is (3S,3aS,4S,5S,6aR)-3-fluoro-5-methyl-4-[(E)-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3S,3aS,4S,5S,6aR)-3-fluoro-5-methyl-4-[(E)-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 18600721 |
| Molecular Formula | C21H33FO4 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (3S,3aS,4S,5S,6aR)-3-fluoro-5-methyl-4-[(E)-3-(oxan-2-yloxy)oct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCCC(/C=C/[C@H]1[C@@H]2[C@H](F)C(=O)O[C@@H]2C[C@@H]1C)OC1CCCCO1 |
| InChI | InChI=1S/C21H33FO4/c1-3-4-5-8-15(25-18-9-6-7-12-24-18)10-11-16-14(2)13-17-19(16)20(22)21(23)26-17/h10-11,14-20H,3-9,12-13H2,1-2H3/b11-10+/t14-,15?,16+,17+,18?,19-,20-/m0/s1 |
| InChIKey | BQYRYSGPVQCUOK-MULIUACASA-N |
| XLogP | 4.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|