C22H35FO4 — CID 18600729
methyl (5Z)-5-[(3aR,4R,5R,6aR)-3-fluoro-4-[(E,3S)-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate (PubChem CID 18600729) has the molecular formula C22H35FO4 and a molecular weight of 382.52 g/mol. Its IUPAC name is methyl (5Z)-5-[(3aR,4R,5R,6aR)-3-fluoro-4-[(E,3S)-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate.
| Compound Name | methyl (5Z)-5-[(3aR,4R,5R,6aR)-3-fluoro-4-[(E,3S)-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate |
|---|---|
| PubChem CID | 18600729 |
| Molecular Formula | C22H35FO4 |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | methyl (5Z)-5-[(3aR,4R,5R,6aR)-3-fluoro-4-[(E,3S)-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H]2C(F)/C(=C/CCCC(=O)OC)O[C@@H]2C[C@H]1C |
| InChI | InChI=1S/C22H35FO4/c1-4-5-6-9-16(24)12-13-17-15(2)14-19-21(17)22(23)18(27-19)10-7-8-11-20(25)26-3/h10,12-13,15-17,19,21-22,24H,4-9,11,14H2,1-3H3/b13-12+,18-10-/t15-,16+,17+,19-,21-,22?/m1/s1 |
| InChIKey | FHJCKIIKNQJDIE-HMKOYCPCSA-N |
| XLogP | 4.72 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|