C6H12O6 — CID 18600751
(2S,3R,4R,5R)-cyclohexane-1,1,2,3,4,5-hexol (PubChem CID 18600751) has the molecular formula C6H12O6 and a molecular weight of 180.16 g/mol. Its IUPAC name is (2S,3R,4R,5R)-cyclohexane-1,1,2,3,4,5-hexol.
| Compound Name | (2S,3R,4R,5R)-cyclohexane-1,1,2,3,4,5-hexol |
|---|---|
| PubChem CID | 18600751 |
| Molecular Formula | C6H12O6 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | (2S,3R,4R,5R)-cyclohexane-1,1,2,3,4,5-hexol |
| SMILES | O[C@@H]1[C@H](O)[C@H](O)CC(O)(O)[C@H]1O |
| InChI | InChI=1S/C6H12O6/c7-2-1-6(11,12)5(10)4(9)3(2)8/h2-5,7-12H,1H2/t2-,3-,4-,5+/m1/s1 |
| InChIKey | XLBBVJOJGOPZNJ-AIHAYLRMSA-N |
| XLogP | -3.49 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|