C23H26N2O9 — CID 18600814
methyl 5-[(3R,3aS,6S,6aS)-6-hydroxy-3-nitrooxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-carbonyl]-2,6-dimethyl-4-(2-methylphenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 18600814) has the molecular formula C23H26N2O9 and a molecular weight of 474.47 g/mol. Its IUPAC name is methyl 5-[(3R,3aS,6S,6aS)-6-hydroxy-3-nitrooxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-carbonyl]-2,6-dimethyl-4-(2-methylphenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | methyl 5-[(3R,3aS,6S,6aS)-6-hydroxy-3-nitrooxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-carbonyl]-2,6-dimethyl-4-(2-methylphenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 18600814 |
| Molecular Formula | C23H26N2O9 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | methyl 5-[(3R,3aS,6S,6aS)-6-hydroxy-3-nitrooxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-carbonyl]-2,6-dimethyl-4-(2-methylphenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)[C@]2(O)CO[C@@H]3[C@H](O[N+](=O)[O-])CO[C@@H]32)C1c1ccccc1C |
| InChI | InChI=1S/C23H26N2O9/c1-11-7-5-6-8-14(11)18-16(12(2)24-13(3)17(18)22(27)31-4)20(26)23(28)10-33-19-15(34-25(29)30)9-32-21(19)23/h5-8,15,18-19,21,24,28H,9-10H2,1-4H3/t15-,18?,19-,21+,23-/m1/s1 |
| InChIKey | GCQFGYQMSKWCJW-SANZVLCRSA-N |
| XLogP | 1.08 |
| TPSA | 146.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|