(2S,3R)-3-methyl-4-oxoazetidine-2-carboxylic acid

C5H7NO3 — CID 18601108

IUPAC(2S,3R)-3-methyl-4-oxoazetidine-2-carboxylic acid
SMILESC[C@H]1C(=O)N[C@@H]1C(=O)O
InChIInChI=1S/C5H7NO3/c1-2-3(5(8)9)6-4(2)7/h2-3H,1H3,(H,6,7)(H,8,9)/t2-,3+/m1/s1
InChIKeyWWHYXGYHXXILGO-GBXIJSLDSA-N
MW129.11 g/mol
LogP-0.79
Rot. Bonds1

About (2S,3R)-3-methyl-4-oxoazetidine-2-carboxylic acid

(2S,3R)-3-methyl-4-oxoazetidine-2-carboxylic acid (PubChem CID 18601108) has the molecular formula C5H7NO3 and a molecular weight of 129.11 g/mol. Its IUPAC name is (2S,3R)-3-methyl-4-oxoazetidine-2-carboxylic acid.

Molecular Properties

Compound Name(2S,3R)-3-methyl-4-oxoazetidine-2-carboxylic acid
PubChem CID18601108
Molecular FormulaC5H7NO3
Molecular Weight129.11 g/mol
Exact Mass129.04
IUPAC Name(2S,3R)-3-methyl-4-oxoazetidine-2-carboxylic acid
SMILESC[C@H]1C(=O)N[C@@H]1C(=O)O
InChIInChI=1S/C5H7NO3/c1-2-3(5(8)9)6-4(2)7/h2-3H,1H3,(H,6,7)(H,8,9)/t2-,3+/m1/s1
InChIKeyWWHYXGYHXXILGO-GBXIJSLDSA-N
XLogP-0.79
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500129.11
LogP ≤ 5-0.79
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2S,3R)-3-methyl-4-oxoazetidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3R)-3-methyl-4-oxoazetidine-2-carboxylic acid?
The IUPAC name of (2S,3R)-3-methyl-4-oxoazetidine-2-carboxylic acid (CID 18601108) is (2S,3R)-3-methyl-4-oxoazetidine-2-carboxylic acid.
What is the SMILES notation for (2S,3R)-3-methyl-4-oxoazetidine-2-carboxylic acid?
The canonical SMILES for (2S,3R)-3-methyl-4-oxoazetidine-2-carboxylic acid is C[C@H]1C(=O)N[C@@H]1C(=O)O.
What is the InChIKey of (2S,3R)-3-methyl-4-oxoazetidine-2-carboxylic acid?
The InChIKey is WWHYXGYHXXILGO-GBXIJSLDSA-N. The full InChI is InChI=1S/C5H7NO3/c1-2-3(5(8)9)6-4(2)7/h2-3H,1H3,(H,6,7)(H,8,9)/t2-,3+/m1/s1.
What are the key properties of (2S,3R)-3-methyl-4-oxoazetidine-2-carboxylic acid?
(2S,3R)-3-methyl-4-oxoazetidine-2-carboxylic acid has a molecular weight of 129.11 g/mol, XLogP of -0.79, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-3-methyl-4-oxoazetidine-2-carboxylic acid is sourced from PubChem (CID 18601108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).