C22H21ClO4 — CID 18601230
benzyl 4-[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]butanoate (PubChem CID 18601230) has the molecular formula C22H21ClO4 and a molecular weight of 384.86 g/mol. Its IUPAC name is benzyl 4-[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]butanoate.
| Compound Name | benzyl 4-[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]butanoate |
|---|---|
| PubChem CID | 18601230 |
| Molecular Formula | C22H21ClO4 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | benzyl 4-[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]butanoate |
| SMILES | O=C(CCCc1cc(Cl)cc2c1OC1C[C@H]3O[C@H]3C21)OCc1ccccc1 |
| InChI | InChI=1S/C22H21ClO4/c23-15-9-14(7-4-8-19(24)25-12-13-5-2-1-3-6-13)21-16(10-15)20-17(26-21)11-18-22(20)27-18/h1-3,5-6,9-10,17-18,20,22H,4,7-8,11-12H2/t17?,18-,20?,22-/m1/s1 |
| InChIKey | SLEXDAOMANFNMF-LPWHEFQBSA-N |
| XLogP | 4.42 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|