C17H19ClO4 — CID 18601234
ethyl 4-[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]butanoate (PubChem CID 18601234) has the molecular formula C17H19ClO4 and a molecular weight of 322.79 g/mol. Its IUPAC name is ethyl 4-[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]butanoate.
| Compound Name | ethyl 4-[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]butanoate |
|---|---|
| PubChem CID | 18601234 |
| Molecular Formula | C17H19ClO4 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | ethyl 4-[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]butanoate |
| SMILES | CCOC(=O)CCCc1cc(Cl)cc2c1OC1C[C@H]3O[C@H]3C21 |
| InChI | InChI=1S/C17H19ClO4/c1-2-20-14(19)5-3-4-9-6-10(18)7-11-15-12(21-16(9)11)8-13-17(15)22-13/h6-7,12-13,15,17H,2-5,8H2,1H3/t12?,13-,15?,17-/m1/s1 |
| InChIKey | SNUCZHXZVCZLNV-YHTQSWCFSA-N |
| XLogP | 3.24 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|