C15H15ClO4 — CID 18601241
4-[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]butanoic acid (PubChem CID 18601241) has the molecular formula C15H15ClO4 and a molecular weight of 294.73 g/mol. Its IUPAC name is 4-[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]butanoic acid.
| Compound Name | 4-[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]butanoic acid |
|---|---|
| PubChem CID | 18601241 |
| Molecular Formula | C15H15ClO4 |
| Molecular Weight | 294.73 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 4-[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]butanoic acid |
| SMILES | O=C(O)CCCc1cc(Cl)cc2c1OC1C[C@H]3O[C@H]3C21 |
| InChI | InChI=1S/C15H15ClO4/c16-8-4-7(2-1-3-12(17)18)14-9(5-8)13-10(19-14)6-11-15(13)20-11/h4-5,10-11,13,15H,1-3,6H2,(H,17,18)/t10?,11-,13?,15-/m1/s1 |
| InChIKey | LEVJLHCGAKSFNE-WGJVFSFXSA-N |
| XLogP | 2.76 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.73 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|