C15H17ClO3 — CID 18601245
4-[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]butan-1-ol (PubChem CID 18601245) has the molecular formula C15H17ClO3 and a molecular weight of 280.75 g/mol. Its IUPAC name is 4-[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]butan-1-ol.
| Compound Name | 4-[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]butan-1-ol |
|---|---|
| PubChem CID | 18601245 |
| Molecular Formula | C15H17ClO3 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 4-[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]butan-1-ol |
| SMILES | OCCCCc1cc(Cl)cc2c1OC1C[C@H]3O[C@H]3C21 |
| InChI | InChI=1S/C15H17ClO3/c16-9-5-8(3-1-2-4-17)14-10(6-9)13-11(18-14)7-12-15(13)19-12/h5-6,11-13,15,17H,1-4,7H2/t11?,12-,13?,15-/m1/s1 |
| InChIKey | UHWWRHHTUIJNRN-HNQLUHSGSA-N |
| XLogP | 2.67 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|