C19H23ClO5 — CID 18601256
(3S,5R)-12-chloro-10-[ethoxy(oxan-2-yloxy)methyl]-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(9),10,12-triene (PubChem CID 18601256) has the molecular formula C19H23ClO5 and a molecular weight of 366.84 g/mol. Its IUPAC name is (3S,5R)-12-chloro-10-[ethoxy(oxan-2-yloxy)methyl]-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(9),10,12-triene.
| Compound Name | (3S,5R)-12-chloro-10-[ethoxy(oxan-2-yloxy)methyl]-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(9),10,12-triene |
|---|---|
| PubChem CID | 18601256 |
| Molecular Formula | C19H23ClO5 |
| Molecular Weight | 366.84 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (3S,5R)-12-chloro-10-[ethoxy(oxan-2-yloxy)methyl]-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(9),10,12-triene |
| SMILES | CCOC(OC1CCCCO1)c1cc(Cl)cc2c1OC1C[C@H]3O[C@H]3C21 |
| InChI | InChI=1S/C19H23ClO5/c1-2-21-19(25-15-5-3-4-6-22-15)12-8-10(20)7-11-16-13(23-17(11)12)9-14-18(16)24-14/h7-8,13-16,18-19H,2-6,9H2,1H3/t13?,14-,15?,16?,18-,19?/m1/s1 |
| InChIKey | ZIXSIUDKMZUUGA-HHLAGLHBSA-N |
| XLogP | 3.93 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.84 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|