C14H15ClO4 — CID 18601261
[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(9),10,12-trien-10-yl]-ethoxymethanol (PubChem CID 18601261) has the molecular formula C14H15ClO4 and a molecular weight of 282.72 g/mol. Its IUPAC name is [(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(9),10,12-trien-10-yl]-ethoxymethanol.
| Compound Name | [(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(9),10,12-trien-10-yl]-ethoxymethanol |
|---|---|
| PubChem CID | 18601261 |
| Molecular Formula | C14H15ClO4 |
| Molecular Weight | 282.72 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | [(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(9),10,12-trien-10-yl]-ethoxymethanol |
| SMILES | CCOC(O)c1cc(Cl)cc2c1OC1C[C@H]3O[C@H]3C21 |
| InChI | InChI=1S/C14H15ClO4/c1-2-17-14(16)8-4-6(15)3-7-11-9(18-12(7)8)5-10-13(11)19-10/h3-4,9-11,13-14,16H,2,5H2,1H3/t9?,10-,11?,13-,14?/m1/s1 |
| InChIKey | CGKIWJHULJYBDZ-ZMYITKRQSA-N |
| XLogP | 2.38 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.72 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|