C20H25ClO4 — CID 18601262
(3S,5R)-12-chloro-10-[4-(oxan-2-yloxy)butyl]-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-triene (PubChem CID 18601262) has the molecular formula C20H25ClO4 and a molecular weight of 364.87 g/mol. Its IUPAC name is (3S,5R)-12-chloro-10-[4-(oxan-2-yloxy)butyl]-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-triene.
| Compound Name | (3S,5R)-12-chloro-10-[4-(oxan-2-yloxy)butyl]-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-triene |
|---|---|
| PubChem CID | 18601262 |
| Molecular Formula | C20H25ClO4 |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (3S,5R)-12-chloro-10-[4-(oxan-2-yloxy)butyl]-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-triene |
| SMILES | Clc1cc(CCCCOC2CCCCO2)c2c(c1)C1C(C[C@H]3O[C@@H]13)O2 |
| InChI | InChI=1S/C20H25ClO4/c21-13-9-12(5-1-3-7-22-17-6-2-4-8-23-17)19-14(10-13)18-15(24-19)11-16-20(18)25-16/h9-10,15-18,20H,1-8,11H2/t15?,16-,17?,18?,20-/m1/s1 |
| InChIKey | IRPYGULCYKNUAW-PKAOKKRLSA-N |
| XLogP | 4.22 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|