C14H15BrO3 — CID 18601291
[(3aR,8bR)-7-bromo-3a,8b-dihydro-3H-cyclopenta[b][1]benzofuran-5-yl]-ethoxymethanol (PubChem CID 18601291) has the molecular formula C14H15BrO3 and a molecular weight of 311.18 g/mol. Its IUPAC name is [(3aR,8bR)-7-bromo-3a,8b-dihydro-3H-cyclopenta[b][1]benzofuran-5-yl]-ethoxymethanol.
| Compound Name | [(3aR,8bR)-7-bromo-3a,8b-dihydro-3H-cyclopenta[b][1]benzofuran-5-yl]-ethoxymethanol |
|---|---|
| PubChem CID | 18601291 |
| Molecular Formula | C14H15BrO3 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | [(3aR,8bR)-7-bromo-3a,8b-dihydro-3H-cyclopenta[b][1]benzofuran-5-yl]-ethoxymethanol |
| SMILES | CCOC(O)c1cc(Br)cc2c1O[C@@H]1CC=C[C@H]21 |
| InChI | InChI=1S/C14H15BrO3/c1-2-17-14(16)11-7-8(15)6-10-9-4-3-5-12(9)18-13(10)11/h3-4,6-7,9,12,14,16H,2,5H2,1H3/t9-,12-,14?/m1/s1 |
| InChIKey | MYQGVPNVOBTVQK-CWCJDUIQSA-N |
| XLogP | 3.28 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|