C14H13ClO4 — CID 18601293
2-[[(3aR,8bR)-7-chloro-3a,8b-dihydro-3H-cyclopenta[b][1]benzofuran-5-yl]methoxy]acetic acid (PubChem CID 18601293) has the molecular formula C14H13ClO4 and a molecular weight of 280.71 g/mol. Its IUPAC name is 2-[[(3aR,8bR)-7-chloro-3a,8b-dihydro-3H-cyclopenta[b][1]benzofuran-5-yl]methoxy]acetic acid.
| Compound Name | 2-[[(3aR,8bR)-7-chloro-3a,8b-dihydro-3H-cyclopenta[b][1]benzofuran-5-yl]methoxy]acetic acid |
|---|---|
| PubChem CID | 18601293 |
| Molecular Formula | C14H13ClO4 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2-[[(3aR,8bR)-7-chloro-3a,8b-dihydro-3H-cyclopenta[b][1]benzofuran-5-yl]methoxy]acetic acid |
| SMILES | O=C(O)COCc1cc(Cl)cc2c1O[C@@H]1CC=C[C@H]21 |
| InChI | InChI=1S/C14H13ClO4/c15-9-4-8(6-18-7-13(16)17)14-11(5-9)10-2-1-3-12(10)19-14/h1-2,4-5,10,12H,3,6-7H2,(H,16,17)/t10-,12-/m1/s1 |
| InChIKey | IKORDSDPIKKNKM-ZYHUDNBSSA-N |
| XLogP | 2.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|