C16H21FO3 — CID 18601480
2-[(4S,5R)-2,2-diethyl-4-(2-fluorophenyl)-1,3-dioxan-5-yl]acetaldehyde (PubChem CID 18601480) has the molecular formula C16H21FO3 and a molecular weight of 280.34 g/mol. Its IUPAC name is 2-[(4S,5R)-2,2-diethyl-4-(2-fluorophenyl)-1,3-dioxan-5-yl]acetaldehyde.
| Compound Name | 2-[(4S,5R)-2,2-diethyl-4-(2-fluorophenyl)-1,3-dioxan-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 18601480 |
| Molecular Formula | C16H21FO3 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 2-[(4S,5R)-2,2-diethyl-4-(2-fluorophenyl)-1,3-dioxan-5-yl]acetaldehyde |
| SMILES | CCC1(CC)OC[C@@H](CC=O)[C@@H](c2ccccc2F)O1 |
| InChI | InChI=1S/C16H21FO3/c1-3-16(4-2)19-11-12(9-10-18)15(20-16)13-7-5-6-8-14(13)17/h5-8,10,12,15H,3-4,9,11H2,1-2H3/t12-,15+/m1/s1 |
| InChIKey | QQYQIJKCKPONIL-DOMZBBRYSA-N |
| XLogP | 3.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|