C7H13N5 — CID 18602
6-butyl-1,3,5-triazine-2,4-diamine (PubChem CID 18602) has the molecular formula C7H13N5 and a molecular weight of 167.22 g/mol. Its IUPAC name is 6-butyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-butyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 18602 |
| Molecular Formula | C7H13N5 |
| Molecular Weight | 167.22 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | 6-butyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C7H13N5/c1-2-3-4-5-10-6(8)12-7(9)11-5/h2-4H2,1H3,(H4,8,9,10,11,12) |
| InChIKey | FMKJZXVUCJWIIV-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.22 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |