C66H120O12 — CID 18602000
[(1R,3S,4R,6S)-1,2,3-tris(decanoyl)-2,3-di(decanoyloxy)-4,5,6-trihydroxycyclohexyl] decanoate (PubChem CID 18602000) has the molecular formula C66H120O12 and a molecular weight of 1105.67 g/mol. Its IUPAC name is [(1R,3S,4R,6S)-1,2,3-tris(decanoyl)-2,3-di(decanoyloxy)-4,5,6-trihydroxycyclohexyl] decanoate.
| Compound Name | [(1R,3S,4R,6S)-1,2,3-tris(decanoyl)-2,3-di(decanoyloxy)-4,5,6-trihydroxycyclohexyl] decanoate |
|---|---|
| PubChem CID | 18602000 |
| Molecular Formula | C66H120O12 |
| Molecular Weight | 1105.67 g/mol |
| Exact Mass | 1104.88 |
| IUPAC Name | [(1R,3S,4R,6S)-1,2,3-tris(decanoyl)-2,3-di(decanoyloxy)-4,5,6-trihydroxycyclohexyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC1(C(=O)CCCCCCCCC)[C@@](OC(=O)CCCCCCCCC)(C(=O)CCCCCCCCC)[C@@H](O)C(O)[C@@H](O)[C@@]1(OC(=O)CCCCCCCCC)C(=O)CCCCCCCCC |
| InChI | InChI=1S/C66H120O12/c1-7-13-19-25-31-37-43-49-55(67)64(76-58(70)52-46-40-34-28-22-16-10-4)62(74)61(73)63(75)65(56(68)50-44-38-32-26-20-14-8-2,77-59(71)53-47-41-35-29-23-17-11-5)66(64,57(69)51-45-39-33-27-21-15-9-3)78-60(72)54-48-42-36-30-24-18-12-6/h61-63,73-75H,7-54H2,1-6H3/t61?,62-,63+,64+,65-,66? |
| InChIKey | OFBFKTKKOHHVKR-MZRCQUBISA-N |
| XLogP | 16.48 |
| TPSA | 190.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1105.67 |
| LogP ≤ 5 | 16.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|