About CID 18602036
CID 18602036 (PubChem CID 18602036) has the molecular formula C33H59N3O6
and a molecular weight of 593.85 g/mol.
Molecular Properties
| Compound Name | CID 18602036 |
| PubChem CID | 18602036 |
| Molecular Formula | C33H59N3O6 |
| Molecular Weight | 593.85 g/mol |
| Exact Mass | 593.44 |
| IUPAC Name | — |
| SMILES | CC1(C)CC2(CC(C)(C)N1)OC[C@@H]1OC3(CC(C)(C)NC(C)(C)C3)O[C@H]([C@H]3COC4(CC(C)(C)NC(C)(C)C4)O3)[C@@H]1O2 |
| InChI | InChI=1S/C33H59N3O6/c1-25(2)15-31(16-26(3,4)34-25)37-13-21(39-31)24-23-22(40-33(42-24)19-29(9,10)36-30(11,12)20-33)14-38-32(41-23)17-27(5,6)35-28(7,8)18-32/h21-24,34-36H,13-20H2,1-12H3/t21-,22+,23-,24-/m1/s1 |
| InChIKey | YESKVWVUVWSJKS-UEQSERJNSA-N |
| XLogP | 4.51 |
| TPSA | 91.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 593.85 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze CID 18602036 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 18602036?
The IUPAC name of CID 18602036 (CID 18602036) is not available.
What is the SMILES notation for CID 18602036?
The canonical SMILES for CID 18602036 is CC1(C)CC2(CC(C)(C)N1)OC[C@@H]1OC3(CC(C)(C)NC(C)(C)C3)O[C@H]([C@H]3COC4(CC(C)(C)NC(C)(C)C4)O3)[C@@H]1O2.
What is the InChIKey of CID 18602036?
The InChIKey is YESKVWVUVWSJKS-UEQSERJNSA-N. The full InChI is InChI=1S/C33H59N3O6/c1-25(2)15-31(16-26(3,4)34-25)37-13-21(39-31)24-23-22(40-33(42-24)19-29(9,10)36-30(11,12)20-33)14-38-32(41-23)17-27(5,6)35-28(7,8)18-32/h21-24,34-36H,13-20H2,1-12H3/t21-,22+,23-,24-/m1/s1.
What are the key properties of CID 18602036?
CID 18602036 has a molecular weight of 593.85 g/mol, XLogP of 4.51, 1 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 18602036 is sourced from PubChem (CID 18602036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).