C39H72O7Si3 — CID 18602050
methyl 3-acetyloxy-7-[(4R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]hept-4-ynoate (PubChem CID 18602050) has the molecular formula C39H72O7Si3 and a molecular weight of 737.26 g/mol. Its IUPAC name is methyl 3-acetyloxy-7-[(4R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]hept-4-ynoate.
| Compound Name | methyl 3-acetyloxy-7-[(4R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]hept-4-ynoate |
|---|---|
| PubChem CID | 18602050 |
| Molecular Formula | C39H72O7Si3 |
| Molecular Weight | 737.26 g/mol |
| Exact Mass | 736.46 |
| IUPAC Name | methyl 3-acetyloxy-7-[(4R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]hept-4-ynoate |
| SMILES | CCCCC(C)(C/C=C/[C@@H]1C(CCC#CC(CC(=O)OC)OC(C)=O)=C(O[Si](C)(C)C(C)(C)C)C[C@H]1O[Si](CC)(CC)CC)O[Si](C)(C)C |
| InChI | InChI=1S/C39H72O7Si3/c1-16-20-27-39(9,46-47(11,12)13)28-23-26-34-33(25-22-21-24-32(43-31(5)40)29-37(41)42-10)35(44-48(14,15)38(6,7)8)30-36(34)45-49(17-2,18-3)19-4/h23,26,32,34,36H,16-20,22,25,27-30H2,1-15H3/b26-23+/t32?,34-,36-,39?/m1/s1 |
| InChIKey | LXIPTIQSWVVORD-SBGQURGTSA-N |
| XLogP | 10.70 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.26 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|