C40H74O6Si3 — CID 18602057
methyl 7-[(4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-6-cyclopentyl-4-methyl-4-trimethylsilyloxyhex-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]-4-hydroxyhept-5-ynoate (PubChem CID 18602057) has the molecular formula C40H74O6Si3 and a molecular weight of 735.28 g/mol. Its IUPAC name is methyl 7-[(4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-6-cyclopentyl-4-methyl-4-trimethylsilyloxyhex-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]-4-hydroxyhept-5-ynoate.
| Compound Name | methyl 7-[(4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-6-cyclopentyl-4-methyl-4-trimethylsilyloxyhex-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]-4-hydroxyhept-5-ynoate |
|---|---|
| PubChem CID | 18602057 |
| Molecular Formula | C40H74O6Si3 |
| Molecular Weight | 735.28 g/mol |
| Exact Mass | 734.48 |
| IUPAC Name | methyl 7-[(4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-6-cyclopentyl-4-methyl-4-trimethylsilyloxyhex-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]-4-hydroxyhept-5-ynoate |
| SMILES | CC[Si](CC)(CC)O[C@H]1CC(O[Si](C)(C)C(C)(C)C)=C(CC#CC(O)CCC(=O)OC)[C@@H]1/C=C/CC(C)(CCC1CCCC1)O[Si](C)(C)C |
| InChI | InChI=1S/C40H74O6Si3/c1-14-49(15-2,16-3)45-37-31-36(44-48(12,13)39(4,5)6)34(24-19-23-33(41)26-27-38(42)43-8)35(37)25-20-29-40(7,46-47(9,10)11)30-28-32-21-17-18-22-32/h20,25,32-33,35,37,41H,14-18,21-22,24,26-31H2,1-13H3/b25-20+/t33?,35-,37-,40?/m0/s1 |
| InChIKey | AADFGPJIUVWRGG-JPUFVFEISA-N |
| XLogP | 10.91 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.28 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|