C38H72O5Si3 — CID 18602058
methyl 8-[(4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]octa-4,5-dienoate (PubChem CID 18602058) has the molecular formula C38H72O5Si3 and a molecular weight of 693.25 g/mol. Its IUPAC name is methyl 8-[(4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]octa-4,5-dienoate.
| Compound Name | methyl 8-[(4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]octa-4,5-dienoate |
|---|---|
| PubChem CID | 18602058 |
| Molecular Formula | C38H72O5Si3 |
| Molecular Weight | 693.25 g/mol |
| Exact Mass | 692.47 |
| IUPAC Name | methyl 8-[(4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]octa-4,5-dienoate |
| SMILES | CCCCC(C)(C/C=C/[C@H]1C(CCC=C=CCCC(=O)OC)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](CC)(CC)CC)O[Si](C)(C)C |
| InChI | InChI=1S/C38H72O5Si3/c1-15-19-29-38(8,43-44(10,11)12)30-25-27-33-32(26-23-21-20-22-24-28-36(39)40-9)34(41-45(13,14)37(5,6)7)31-35(33)42-46(16-2,17-3)18-4/h21-22,25,27,33,35H,15-19,23-24,26,28-31H2,1-14H3/b27-25+/t20?,33-,35-,38?/m0/s1 |
| InChIKey | CQWXGEQBUBIOEM-IIVSRCIWSA-N |
| XLogP | 11.86 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.25 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|