About 2-(1,3,4-thiadiazol-2-yloxy)acetamide
2-(1,3,4-thiadiazol-2-yloxy)acetamide (PubChem CID 18602116) has the molecular formula C4H5N3O2S
and a molecular weight of 159.17 g/mol. Its IUPAC name is 2-(1,3,4-thiadiazol-2-yloxy)acetamide.
Molecular Properties
| Compound Name | 2-(1,3,4-thiadiazol-2-yloxy)acetamide |
| PubChem CID | 18602116 |
| Molecular Formula | C4H5N3O2S |
| Molecular Weight | 159.17 g/mol |
| Exact Mass | 159.01 |
| IUPAC Name | 2-(1,3,4-thiadiazol-2-yloxy)acetamide |
| SMILES | NC(=O)COc1nncs1 |
| InChI | InChI=1S/C4H5N3O2S/c5-3(8)1-9-4-7-6-2-10-4/h2H,1H2,(H2,5,8) |
| InChIKey | TUMFHRSSMDZROA-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.17 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,3,4-thiadiazol-2-yloxy)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3,4-thiadiazol-2-yloxy)acetamide?
The IUPAC name of 2-(1,3,4-thiadiazol-2-yloxy)acetamide (CID 18602116) is 2-(1,3,4-thiadiazol-2-yloxy)acetamide.
What is the SMILES notation for 2-(1,3,4-thiadiazol-2-yloxy)acetamide?
The canonical SMILES for 2-(1,3,4-thiadiazol-2-yloxy)acetamide is NC(=O)COc1nncs1.
What is the InChIKey of 2-(1,3,4-thiadiazol-2-yloxy)acetamide?
The InChIKey is TUMFHRSSMDZROA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3O2S/c5-3(8)1-9-4-7-6-2-10-4/h2H,1H2,(H2,5,8).
What are the key properties of 2-(1,3,4-thiadiazol-2-yloxy)acetamide?
2-(1,3,4-thiadiazol-2-yloxy)acetamide has a molecular weight of 159.17 g/mol, XLogP of -0.60, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3,4-thiadiazol-2-yloxy)acetamide is sourced from PubChem (CID 18602116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).