C14H26ClN — CID 18602170
(3R,8aR)-3-cyclohexyl-1,2,3,5,6,7,8,8a-octahydroindolizine;hydrochloride (PubChem CID 18602170) has the molecular formula C14H26ClN and a molecular weight of 243.82 g/mol. Its IUPAC name is (3R,8aR)-3-cyclohexyl-1,2,3,5,6,7,8,8a-octahydroindolizine;hydrochloride.
| Compound Name | (3R,8aR)-3-cyclohexyl-1,2,3,5,6,7,8,8a-octahydroindolizine;hydrochloride |
|---|---|
| PubChem CID | 18602170 |
| Molecular Formula | C14H26ClN |
| Molecular Weight | 243.82 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | (3R,8aR)-3-cyclohexyl-1,2,3,5,6,7,8,8a-octahydroindolizine;hydrochloride |
| SMILES | C1CCC([C@H]2CC[C@H]3CCCCN32)CC1.Cl |
| InChI | InChI=1S/C14H25N.ClH/c1-2-6-12(7-3-1)14-10-9-13-8-4-5-11-15(13)14;/h12-14H,1-11H2;1H/t13-,14-;/m1./s1 |
| InChIKey | BKDCPIYMBAODRS-DTPOWOMPSA-N |
| XLogP | 4.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.82 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |