C11H15NO6S3 — CID 18602613
methyl (6R,7S)-3-methyl-7-[(1R)-1-methylsulfonyloxyethyl]-8-oxo-4,5-dithia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 18602613) has the molecular formula C11H15NO6S3 and a molecular weight of 353.44 g/mol. Its IUPAC name is methyl (6R,7S)-3-methyl-7-[(1R)-1-methylsulfonyloxyethyl]-8-oxo-4,5-dithia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | methyl (6R,7S)-3-methyl-7-[(1R)-1-methylsulfonyloxyethyl]-8-oxo-4,5-dithia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 18602613 |
| Molecular Formula | C11H15NO6S3 |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | methyl (6R,7S)-3-methyl-7-[(1R)-1-methylsulfonyloxyethyl]-8-oxo-4,5-dithia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | COC(=O)C1=C(C)SS[C@@H]2[C@@H]([C@@H](C)OS(C)(=O)=O)C(=O)N12 |
| InChI | InChI=1S/C11H15NO6S3/c1-5(18-21(4,15)16)7-9(13)12-8(11(14)17-3)6(2)19-20-10(7)12/h5,7,10H,1-4H3/t5-,7+,10-/m1/s1 |
| InChIKey | NYOMWFJIWWVHQZ-NJUACVTBSA-N |
| XLogP | 0.94 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|