About (3R,5R)-oxane-3,4,5-triol
(3R,5R)-oxane-3,4,5-triol (PubChem CID 18602743) has the molecular formula C5H10O4
and a molecular weight of 134.13 g/mol. Its IUPAC name is (3R,5R)-oxane-3,4,5-triol.
Molecular Properties
| Compound Name | (3R,5R)-oxane-3,4,5-triol |
| PubChem CID | 18602743 |
| Molecular Formula | C5H10O4 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | (3R,5R)-oxane-3,4,5-triol |
| SMILES | OC1[C@H](O)COC[C@H]1O |
| InChI | InChI=1S/C5H10O4/c6-3-1-9-2-4(7)5(3)8/h3-8H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | QXAMTEJJAZOINB-QWWZWVQMSA-N |
| XLogP | -1.90 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R,5R)-oxane-3,4,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5R)-oxane-3,4,5-triol?
The IUPAC name of (3R,5R)-oxane-3,4,5-triol (CID 18602743) is (3R,5R)-oxane-3,4,5-triol.
What is the SMILES notation for (3R,5R)-oxane-3,4,5-triol?
The canonical SMILES for (3R,5R)-oxane-3,4,5-triol is OC1[C@H](O)COC[C@H]1O.
What is the InChIKey of (3R,5R)-oxane-3,4,5-triol?
The InChIKey is QXAMTEJJAZOINB-QWWZWVQMSA-N. The full InChI is InChI=1S/C5H10O4/c6-3-1-9-2-4(7)5(3)8/h3-8H,1-2H2/t3-,4-/m1/s1.
What are the key properties of (3R,5R)-oxane-3,4,5-triol?
(3R,5R)-oxane-3,4,5-triol has a molecular weight of 134.13 g/mol, XLogP of -1.90, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5R)-oxane-3,4,5-triol is sourced from PubChem (CID 18602743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).