C16H30ClN3O7 — CID 18602954
1-[(3R,4R,5R,6S)-6-butan-2-yloxy-3,4,5-trihydroxyoxan-3-yl]-3-(2-chloroethyl)-1-(2-methylpropyl)-3-nitrosourea (PubChem CID 18602954) has the molecular formula C16H30ClN3O7 and a molecular weight of 411.88 g/mol. Its IUPAC name is 1-[(3R,4R,5R,6S)-6-butan-2-yloxy-3,4,5-trihydroxyoxan-3-yl]-3-(2-chloroethyl)-1-(2-methylpropyl)-3-nitrosourea.
| Compound Name | 1-[(3R,4R,5R,6S)-6-butan-2-yloxy-3,4,5-trihydroxyoxan-3-yl]-3-(2-chloroethyl)-1-(2-methylpropyl)-3-nitrosourea |
|---|---|
| PubChem CID | 18602954 |
| Molecular Formula | C16H30ClN3O7 |
| Molecular Weight | 411.88 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 1-[(3R,4R,5R,6S)-6-butan-2-yloxy-3,4,5-trihydroxyoxan-3-yl]-3-(2-chloroethyl)-1-(2-methylpropyl)-3-nitrosourea |
| SMILES | CCC(C)O[C@@H]1OC[C@](O)(N(CC(C)C)C(=O)N(CCCl)N=O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H30ClN3O7/c1-5-11(4)27-14-12(21)13(22)16(24,9-26-14)19(8-10(2)3)15(23)20(18-25)7-6-17/h10-14,21-22,24H,5-9H2,1-4H3/t11?,12-,13-,14+,16-/m1/s1 |
| InChIKey | QDBXZQPTONKHFO-XIZCSFOISA-N |
| XLogP | 0.87 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.88 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|