C20H25BrO10S — CID 18603557
[(3R,4R,5R,6R)-4,5-diacetyl-2-bromo-4,5-dihydroxy-6-(1-hydroxy-2-oxopropyl)oxan-3-yl] (4-methylphenyl)methanesulfonate (PubChem CID 18603557) has the molecular formula C20H25BrO10S and a molecular weight of 537.38 g/mol. Its IUPAC name is [(3R,4R,5R,6R)-4,5-diacetyl-2-bromo-4,5-dihydroxy-6-(1-hydroxy-2-oxopropyl)oxan-3-yl] (4-methylphenyl)methanesulfonate.
| Compound Name | [(3R,4R,5R,6R)-4,5-diacetyl-2-bromo-4,5-dihydroxy-6-(1-hydroxy-2-oxopropyl)oxan-3-yl] (4-methylphenyl)methanesulfonate |
|---|---|
| PubChem CID | 18603557 |
| Molecular Formula | C20H25BrO10S |
| Molecular Weight | 537.38 g/mol |
| Exact Mass | 536.04 |
| IUPAC Name | [(3R,4R,5R,6R)-4,5-diacetyl-2-bromo-4,5-dihydroxy-6-(1-hydroxy-2-oxopropyl)oxan-3-yl] (4-methylphenyl)methanesulfonate |
| SMILES | CC(=O)C(O)[C@H]1OC(Br)[C@H](OS(=O)(=O)Cc2ccc(C)cc2)[C@](O)(C(C)=O)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C20H25BrO10S/c1-10-5-7-14(8-6-10)9-32(28,29)31-17-18(21)30-16(15(25)11(2)22)19(26,12(3)23)20(17,27)13(4)24/h5-8,15-18,25-27H,9H2,1-4H3/t15?,16-,17+,18?,19-,20-/m1/s1 |
| InChIKey | GMOLTLXMNFTGOM-MAGMXMNTSA-N |
| XLogP | -0.08 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.38 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|