C14H20ClNO2 — CID 18603865
(4aR,10bS)-10-methoxy-4-methyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridine;hydrochloride (PubChem CID 18603865) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is (4aR,10bS)-10-methoxy-4-methyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridine;hydrochloride.
| Compound Name | (4aR,10bS)-10-methoxy-4-methyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridine;hydrochloride |
|---|---|
| PubChem CID | 18603865 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | (4aR,10bS)-10-methoxy-4-methyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridine;hydrochloride |
| SMILES | COc1cccc2c1[C@@H]1CCCN(C)[C@H]1CO2.Cl |
| InChI | InChI=1S/C14H19NO2.ClH/c1-15-8-4-5-10-11(15)9-17-13-7-3-6-12(16-2)14(10)13;/h3,6-7,10-11H,4-5,8-9H2,1-2H3;1H/t10-,11+;/m1./s1 |
| InChIKey | PJCJWWZRPVDQDY-DHXVBOOMSA-N |
| XLogP | 2.69 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |