C16H22BrNO2 — CID 18603889
(4aR,10bS)-7-bromo-10-methoxy-4-propyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridine (PubChem CID 18603889) has the molecular formula C16H22BrNO2 and a molecular weight of 340.26 g/mol. Its IUPAC name is (4aR,10bS)-7-bromo-10-methoxy-4-propyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridine.
| Compound Name | (4aR,10bS)-7-bromo-10-methoxy-4-propyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridine |
|---|---|
| PubChem CID | 18603889 |
| Molecular Formula | C16H22BrNO2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | (4aR,10bS)-7-bromo-10-methoxy-4-propyl-1,2,3,4a,5,10b-hexahydrochromeno[3,4-b]pyridine |
| SMILES | CCCN1CCC[C@H]2c3c(OC)ccc(Br)c3OC[C@@H]21 |
| InChI | InChI=1S/C16H22BrNO2/c1-3-8-18-9-4-5-11-13(18)10-20-16-12(17)6-7-14(19-2)15(11)16/h6-7,11,13H,3-5,8-10H2,1-2H3/t11-,13+/m1/s1 |
| InChIKey | AQNBABXSPUKODM-YPMHNXCESA-N |
| XLogP | 3.81 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |