C27H40O4Si — CID 18604175
(1'R,2'S,3'R,6'S)-2'-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylpent-1-ynyl]spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol (PubChem CID 18604175) has the molecular formula C27H40O4Si and a molecular weight of 456.70 g/mol. Its IUPAC name is (1'R,2'S,3'R,6'S)-2'-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylpent-1-ynyl]spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol.
| Compound Name | (1'R,2'S,3'R,6'S)-2'-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylpent-1-ynyl]spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol |
|---|---|
| PubChem CID | 18604175 |
| Molecular Formula | C27H40O4Si |
| Molecular Weight | 456.70 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | (1'R,2'S,3'R,6'S)-2'-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylpent-1-ynyl]spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](C#C[C@@H]1[C@H]2CC3(OCCO3)[C@H]2CC[C@H]1O)CCc1ccccc1 |
| InChI | InChI=1S/C27H40O4Si/c1-26(2,3)32(4,5)31-21(12-11-20-9-7-6-8-10-20)13-14-22-23-19-27(29-17-18-30-27)24(23)15-16-25(22)28/h6-10,21-25,28H,11-12,15-19H2,1-5H3/t21-,22-,23-,24+,25-/m1/s1 |
| InChIKey | CASLEMAZHPOTNQ-UUFXTFJOSA-N |
| XLogP | 5.16 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.70 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|