C34H65FO6Si2 — CID 18604462
methyl (5R)-5-[(2R,3aR,4R,5R,6aS)-2-methoxy-5-triethylsilyloxy-4-[(E,3S)-3-triethylsilyloxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-yl]-5-fluoropentanoate (PubChem CID 18604462) has the molecular formula C34H65FO6Si2 and a molecular weight of 645.06 g/mol. Its IUPAC name is methyl (5R)-5-[(2R,3aR,4R,5R,6aS)-2-methoxy-5-triethylsilyloxy-4-[(E,3S)-3-triethylsilyloxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-yl]-5-fluoropentanoate.
| Compound Name | methyl (5R)-5-[(2R,3aR,4R,5R,6aS)-2-methoxy-5-triethylsilyloxy-4-[(E,3S)-3-triethylsilyloxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-yl]-5-fluoropentanoate |
|---|---|
| PubChem CID | 18604462 |
| Molecular Formula | C34H65FO6Si2 |
| Molecular Weight | 645.06 g/mol |
| Exact Mass | 644.43 |
| IUPAC Name | methyl (5R)-5-[(2R,3aR,4R,5R,6aS)-2-methoxy-5-triethylsilyloxy-4-[(E,3S)-3-triethylsilyloxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-yl]-5-fluoropentanoate |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@H]2C[C@](OC)([C@H](F)CCCC(=O)OC)O[C@H]2C[C@H]1O[Si](CC)(CC)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C34H65FO6Si2/c1-10-17-18-20-27(40-42(11-2,12-3)13-4)23-24-28-29-26-34(38-9,32(35)21-19-22-33(36)37-8)39-30(29)25-31(28)41-43(14-5,15-6)16-7/h23-24,27-32H,10-22,25-26H2,1-9H3/b24-23+/t27-,28+,29+,30-,31+,32+,34+/m0/s1 |
| InChIKey | BTBDGUSDSVZMND-FDLHPZLFSA-N |
| XLogP | 9.35 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.06 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|