C21H30O10S2 — CID 18604536
(3aS,4R,7aR)-4-[(1R)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]-2,2,7a-trimethyl-6-(methylsulfanylmethoxy)-4,7-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-carboxylic acid (PubChem CID 18604536) has the molecular formula C21H30O10S2 and a molecular weight of 506.60 g/mol. Its IUPAC name is (3aS,4R,7aR)-4-[(1R)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]-2,2,7a-trimethyl-6-(methylsulfanylmethoxy)-4,7-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-carboxylic acid.
| Compound Name | (3aS,4R,7aR)-4-[(1R)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]-2,2,7a-trimethyl-6-(methylsulfanylmethoxy)-4,7-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 18604536 |
| Molecular Formula | C21H30O10S2 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | (3aS,4R,7aR)-4-[(1R)-1-hydroxy-2-(4-methylphenyl)sulfonyloxyethyl]-2,2,7a-trimethyl-6-(methylsulfanylmethoxy)-4,7-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-carboxylic acid |
| SMILES | CSCOC1(C(=O)O)C[C@@]2(C)OC(C)(C)O[C@H]2[C@@H]([C@H](O)COS(=O)(=O)c2ccc(C)cc2)O1 |
| InChI | InChI=1S/C21H30O10S2/c1-13-6-8-14(9-7-13)33(25,26)28-10-15(22)16-17-20(4,31-19(2,3)30-17)11-21(29-16,18(23)24)27-12-32-5/h6-9,15-17,22H,10-12H2,1-5H3,(H,23,24)/t15-,16-,17+,20-,21?/m1/s1 |
| InChIKey | BDGRKGNZECPLID-NOSRPZSHSA-N |
| XLogP | 1.88 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|