C32H50O9 — CID 18605461
(4-methoxy-4-oxobutyl) (3aR,6aS)-2-(oxan-2-yloxy)-1-[(E)-8-(oxan-2-yloxy)oct-1-enyl]-5-oxo-1,2,3,4,6,6a-hexahydropentalene-3a-carboxylate (PubChem CID 18605461) has the molecular formula C32H50O9 and a molecular weight of 578.74 g/mol. Its IUPAC name is (4-methoxy-4-oxobutyl) (3aR,6aS)-2-(oxan-2-yloxy)-1-[(E)-8-(oxan-2-yloxy)oct-1-enyl]-5-oxo-1,2,3,4,6,6a-hexahydropentalene-3a-carboxylate.
| Compound Name | (4-methoxy-4-oxobutyl) (3aR,6aS)-2-(oxan-2-yloxy)-1-[(E)-8-(oxan-2-yloxy)oct-1-enyl]-5-oxo-1,2,3,4,6,6a-hexahydropentalene-3a-carboxylate |
|---|---|
| PubChem CID | 18605461 |
| Molecular Formula | C32H50O9 |
| Molecular Weight | 578.74 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | (4-methoxy-4-oxobutyl) (3aR,6aS)-2-(oxan-2-yloxy)-1-[(E)-8-(oxan-2-yloxy)oct-1-enyl]-5-oxo-1,2,3,4,6,6a-hexahydropentalene-3a-carboxylate |
| SMILES | COC(=O)CCCOC(=O)[C@]12CC(=O)C[C@H]1C(/C=C/CCCCCCOC1CCCCO1)C(OC1CCCCO1)C2 |
| InChI | InChI=1S/C32H50O9/c1-36-28(34)14-12-20-40-31(35)32-22-24(33)21-26(32)25(27(23-32)41-30-16-8-11-19-39-30)13-6-4-2-3-5-9-17-37-29-15-7-10-18-38-29/h6,13,25-27,29-30H,2-5,7-12,14-23H2,1H3/b13-6+/t25?,26-,27?,29?,30?,32-/m0/s1 |
| InChIKey | YPLRWMAVLZEFAP-IUPQUJIJSA-N |
| XLogP | 5.43 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.74 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|