C19H23NO5 — CID 18605737
[(3R,4S)-6-acetyl-2,2-dimethyl-4-(2-oxopiperidin-1-yl)-3,4-dihydrochromen-3-yl] formate (PubChem CID 18605737) has the molecular formula C19H23NO5 and a molecular weight of 345.39 g/mol. Its IUPAC name is [(3R,4S)-6-acetyl-2,2-dimethyl-4-(2-oxopiperidin-1-yl)-3,4-dihydrochromen-3-yl] formate.
| Compound Name | [(3R,4S)-6-acetyl-2,2-dimethyl-4-(2-oxopiperidin-1-yl)-3,4-dihydrochromen-3-yl] formate |
|---|---|
| PubChem CID | 18605737 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | [(3R,4S)-6-acetyl-2,2-dimethyl-4-(2-oxopiperidin-1-yl)-3,4-dihydrochromen-3-yl] formate |
| SMILES | CC(=O)c1ccc2c(c1)[C@H](N1CCCCC1=O)[C@@H](OC=O)C(C)(C)O2 |
| InChI | InChI=1S/C19H23NO5/c1-12(22)13-7-8-15-14(10-13)17(20-9-5-4-6-16(20)23)18(24-11-21)19(2,3)25-15/h7-8,10-11,17-18H,4-6,9H2,1-3H3/t17-,18+/m0/s1 |
| InChIKey | YQBVDNKGGMZGSQ-ZWKOTPCHSA-N |
| XLogP | 2.66 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|