C20H21N5O — CID 18605898
(6aR,9R)-7-methyl-N-pyrimidin-4-yl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 18605898) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is (6aR,9R)-7-methyl-N-pyrimidin-4-yl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,9R)-7-methyl-N-pyrimidin-4-yl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 18605898 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (6aR,9R)-7-methyl-N-pyrimidin-4-yl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CN1C[C@H](C(=O)Nc2ccncn2)CC2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C20H21N5O/c1-25-10-13(20(26)24-18-5-6-21-11-23-18)7-15-14-3-2-4-16-19(14)12(9-22-16)8-17(15)25/h2-6,9,11,13,15,17,22H,7-8,10H2,1H3,(H,21,23,24,26)/t13-,15?,17-/m1/s1 |
| InChIKey | PWVFOXNIAZZEIV-GWHNWCKOSA-N |
| XLogP | 2.56 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |