C20H38O4Si — CID 18605955
(1R,2S,3R,4S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(oxan-2-yloxy)-2-prop-2-enylcyclopentan-1-ol (PubChem CID 18605955) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(oxan-2-yloxy)-2-prop-2-enylcyclopentan-1-ol.
| Compound Name | (1R,2S,3R,4S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(oxan-2-yloxy)-2-prop-2-enylcyclopentan-1-ol |
|---|---|
| PubChem CID | 18605955 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | (1R,2S,3R,4S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(oxan-2-yloxy)-2-prop-2-enylcyclopentan-1-ol |
| SMILES | C=CC[C@H]1[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OC2CCCCO2)C[C@H]1O |
| InChI | InChI=1S/C20H38O4Si/c1-7-10-15-16(14-23-25(5,6)20(2,3)4)18(13-17(15)21)24-19-11-8-9-12-22-19/h7,15-19,21H,1,8-14H2,2-6H3/t15-,16-,17+,18-,19?/m0/s1 |
| InChIKey | IOYZTSOVUOWILK-BMMZCLLGSA-N |
| XLogP | 4.49 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|